| Identification | |
| Name: | Ethene,1,1-dibromo-2,2-difluoro- |
| Synonyms: | Ethylene,1,1-dibromo-2,2-difluoro- (6CI,7CI,8CI); 1,1-Dibromo-2,2-difluoroethene;1,1-Dibromo-2,2-difluoroethylene; 1,1-Dibromodifluoroethene |
| CAS: | 430-85-3 |
| EINECS: | 207-068-2 |
| Molecular Formula: | C2Br2 F2 |
| Molecular Weight: | 221.83 |
| InChI: | InChI=1/C2Br2F2/c3-1(4)2(5)6 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2810 |
| Flash Point: | °C |
| Boiling Point: | 68.7°Cat760mmHg |
| Density: | 2.41g/cm3 |
| Refractive index: | 1.4458 |
| Specification: | Safety Statements:23-36/37/39-45 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Flash Point: | °C |
| Safety Data | |
| Hazard Symbols |
T: Toxic
|
 |
|
