| Identification | |
| Name: | 5-Amino-2-phenylbenzothiazole |
| Synonyms: | 2-Phenyl-5-benzothiazolamine |
| CAS: | 43087-91-8 |
| Molecular Formula: | C13H10N2S |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C13H10N2S/c14-10-6-7-12-11(8-10)15-13(16-12)9-4-2-1-3-5-9/h1-8H,14H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 214.4°C |
| Boiling Point: | 430.9°C at 760 mmHg |
| Density: | 1.301g/cm3 |
| Refractive index: | 1.73 |
| Specification: |
5-Amino-2-phenylbenzothiazole ,with CAS number of 43087-91-8,can be called 2-Fenyl-5-aminobenzthiazol ; 5-Amino-2-fenylbenzthiazol and FABT . 5-Amino-2-phenylbenzothiazole (CAS NO.43087-91-8) is a moderately toxic substance,with flammability, burning will produce toxic fumes of nitrogen oxides and sulfur oxides,so it should be stored in cool and dry environment,dry powder,foam,sand, carbon dioxide,water mist can be used if something urgent happened. |
| Flash Point: | 214.4°C |
| Safety Data | |
 |
|
