| Identification | |
| Name: | 2,3-Butanedione |
| Synonyms: | DIACETYLE; Biacetyl; Diacetyl |
| CAS: | 431-03-8 |
| EINECS: | 207-069-8 |
| Molecular Formula: | C4H6O2 |
| Molecular Weight: | 86.09 |
| InChI: | InChI=1/C4H6O2/c1-3(5)4(2)6/h1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2346 |
| Density: | 0.981 |
| Stability: | Stable. Flammable. Incompatible with acids, strong bases, metals, reducing agents, oxidizing agents. Protect from moisture and water. Note low flashpoint. |
| Refractive index: | 1.391-1.399 |
| Solubility: | 200 g/L (20 oC) in water |
| Appearance: | Yellow to yellow-green liquid |
| Specification: | liquid with a butter-like odour usageEng:Inactivates aminopeptidase-N.1 Cyclocondensation with amines has been used to form triazine2 and pteridine ring systems.3 Also used as a precursor to α-diones.4 Safety Statements:9-16-26-37/39-36/37/39-39 9:Keep container in a well-ventilated place 16:Keep away from sources of ignition - No smoking 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 39:Wear eye/face protection |
| Packinggroup: | II |
| HS Code: | 29141990 |
| Color: | Greenish-yellow liquid Yellow liquid |
| Usage: | Carrier of aroma of butter, vinegar, coffee & other foods. |
| Safety Data | |
| Hazard Symbols |
F:Flammable
|
 |
|
