Identification |
Name: | Ethane,1,2-dichloro-1,2-difluoro- |
Synonyms: | 1,2-Dichloro-1,2-difluoroethane;1,2-Difluoro-1,2-dichloroethane; Freon 132; HCFC 132; R 132; R 132(refrigerant) |
CAS: | 431-06-1 |
EINECS: | 207-070-3 |
Molecular Formula: | C2H2 Cl2 F2 |
Molecular Weight: | 134.94 |
InChI: | InChI=1/C2H2Cl2F2/c3-1(5)2(4)6/h1-2H |
Molecular Structure: |
 |
Properties |
Transport: | 3082 |
Melting Point: | -155°C |
Flash Point: | °C |
Boiling Point: | 58-59°C |
Density: | 1.416g/cm3 |
Refractive index: | 1.376 |
Specification: | Safety Statements:23-36/37/39 23:Do not breathe gas/fumes/vapor/spray (appropriate wording
to be specified by the manufacturer) 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Flash Point: | °C |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
 |