Identification |
Name: | Acetamide,2-fluoro-2-iodo- |
Synonyms: | IODOFLUOROACETAMIDE;FLUOROIODOACETAMIDE;2-Iodo-2-fluoroacetamide;IODOFLUOROACETIMIDE |
CAS: | 431-13-0 |
Molecular Formula: | C2H3 F I N O |
Molecular Weight: | 202.95 |
InChI: | InChI=1/C2H3FINO/c3-1(4)2(5)6/h1H,(H2,5,6) |
Molecular Structure: |
 |
Properties |
Flash Point: | 122.2°C |
Boiling Point: | 278.5°C at 760 mmHg |
Density: | 2.332g/cm3 |
Refractive index: | 1.556 |
Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Flash Point: | 122.2°C |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
 |