| Identification | |
| Name: | Tris(4-bromophenyl)amine |
| Synonyms: | Triphenylamine,4,4',4''-tribromo- (7CI,8CI);4,4',4''-Tribromotriphenylamine;N,N-Diphenyl-4,4',4''-tribromoaniline;NSC 86666;Tri(4-bromophenyl)amine;Tri(p-bromophenyl)amine;p,p',p''-Tribromotriphenylamine; |
| CAS: | 4316-58-9 |
| Molecular Formula: | C18H12Br3N |
| Molecular Weight: | 482.01 |
| InChI: | InChI=1/C18H12Br3N/c19-13-1-7-16(8-2-13)22(17-9-3-14(20)4-10-17)18-11-5-15(21)6-12-18/h1-12H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.79 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.692 |
| Appearance: | pale green powder |
| Specification: |
?Tris(4-bromophenyl)amine , its cas register number is 4316-58-9. It also can be called Benzenamine,4-bromo-N,N-bis(4-bromophenyl)- ; Triphenylamine,4,4',4''-tribromo- (7CI,8CI) ; N,N-Diphenyl-4,4',4''-tribromoaniline ; Tri(p-bromophenyl)amine .It is a?pale green powder. |
| Storage Temperature: | Refrigerator |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
