| Identification | |
| Name: | Pyrimidine,4,6-dichloro-5-nitro- |
| Synonyms: | NSC 89693;4,6-Dichloro-5-Nitro-Pyrimidine; |
| CAS: | 4316-93-2 |
| EINECS: | 224-340-6 |
| Molecular Formula: | C4HCl2N3O2 |
| Molecular Weight: | 193.98 |
| InChI: | InChI=1/C4HCl2N3O2/c5-3-2(9(10)11)4(6)8-1-7-3/h1H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.737 g/cm3 |
| Refractive index: | 1.611 |
| Appearance: | Yellow crystalline solid |
| Specification: |
Pyrimidine, 4,6-dichloro-5-nitro- , with CAS number of 4316-93-2, can be called 4,6-Dichloro-5-nitropyrimidine ; 4,6-Dichlor-5-nitropyrimidin . It is a yellow crystalline solid. |
| Storage Temperature: | Refrigerator |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
