| Identification | |
| Name: | 1-Isopropylpiperazine |
| Synonyms: | Piperazine,1-isopropyl- (6CI,7CI,8CI);1-(1-Methylethyl)piperazine;1-(Propan-2-yl)piperazine;4-Isopropylpiperazine;Isopropylpiperazine;N-Isopropylpiperazine; |
| CAS: | 4318-42-7 |
| EINECS: | 224-345-3 |
| Molecular Formula: | C7H16N2 |
| Molecular Weight: | 128.21 |
| InChI: | InChI=1/C7H16N2/c1-7(2)9-5-3-8-4-6-9/h7-8H,3-6H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1992 |
| Density: | 0.896 |
| Refractive index: | 1.47-1.472 |
| Appearance: | Clear pale yellow liquid |
| Specification: |
1-Isopropylpiperazine , with CAS number of 4318-42-7, can be called 1-(1-Methylethyl)piperazine ; 1-(Propan-2-yl)piperazine ; 1-Isopropylpiperazine ; 4-Isopropylpiperazine ; Isopropylpiperazine ; N-Isopropylpiperazine . It is a clear pale yellow liquid. |
| Packinggroup: | III |
| Storage Temperature: | Flammables area |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
