| Identification | |
| Name: | Benzeneacetic acid, a-amino-4-chloro-, (aR)- |
| Synonyms: | Benzeneaceticacid, a-amino-4-chloro-, (R)-;(R)-2-Amino-2-(4-chlorophenyl)ethanoic acid;D-(4-Chlorophenyl)glycine;D-p-Chlorophenylglycine; |
| CAS: | 43189-37-3 |
| Molecular Formula: | C8H8ClNO2 |
| Molecular Weight: | 185.61 |
| InChI: | InChI=1/C8H8ClNO2/c9-6-3-1-5(2-4-6)7(10)8(11)12/h1-4,7H,10H2,(H,11,12)/t7-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.392 g/cm3 |
| Refractive index: | 1.603 |
| Specification: |
The D(-)-4-Chlorophenylglycine with the cas number 43189-37-3 is also called Benzeneacetic acid, a-amino-4-chloro-, (aR)-. The IUPAC name is (2R)-2-amino-2-(4-chlorophenyl)acetic acid. Its molecular formula is C8H8ClNO2. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the chemical are: (1)ACD/LogP: 1.54; (2)# of Rule of 5 Violations: 0 ; (3)#H bond acceptors: 3; (4)#H bond donors: 3; (5)#Freely Rotating Bonds: 3; (6)Polar Surface Area: 29.54 Å2; (7)Index of Refraction: 1.603; (8)Molar Refractivity: 45.79 cm3; (9)Molar Volume: 133.2 cm3; (10)Polarizability: 18.15×10-24cm3; (11)Surface Tension: 58.9 dyne/cm; (12)Enthalpy of Vaporization: 60.3 kJ/mol; (13)Vapour Pressure: 7.45×10-5 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
