| Identification | |
| Name: | Carbamicacid, N-[6-(phenylthio)-1H-benzimidazol-2-yl]-, methyl ester |
| Synonyms: | Carbamicacid, [5-(phenylthio)-1H-benzimidazol-2-yl]-, methyl ester (9CI);2-(Methoxycarbonylamino)-5-(phenylthio)benzimidazole;Axilur;Fenbendazol;Fenbion;HOE 881;Methyl5-(phenylthio)-2-benzimidazolecarbamate;Methyl[5-(phenylthio)-1H-benzimidazol-2-yl]carbamate;Panacur;Safe-Guard; |
| CAS: | 43210-67-9 |
| EINECS: | 256-145-7 |
| Molecular Formula: | C15H13N3O2S |
| Molecular Weight: | 299.34762 |
| InChI: | InChI=1S/C15H13N3O2S/c1-20-15(19)18-14-16-12-8-7-11(9-13(12)17-14)21-10-5-3-2-4-6-10/h2-9H,1H3,(H2,16,17,18,19) |
| Molecular Structure: | ![(C15H13N3O2S) Carbamicacid, [5-(phenylthio)-1H-benzimidazol-2-yl]-, methyl ester (9CI);2-(Methoxycarbonylamino)-5-...](https://img.guidechem.com/casimg/43210-67-9.gif) |
| Properties | |
| Transport: | HAZARD |
| Density: | 1.4 g/cm3 |
| Stability: | Stable at normal temperatures and pressures. |
| Refractive index: | 1.709 |
| Water Solubility: | Insoluble |
| Solubility: | Insoluble Appearance:white to yellowish powder Transport Information:HAZARD Hazard Symbols:UN NO. Deleted CAS:53571-02-1 |
| Appearance: | white to yellowish powder |
| Specification: | Off-White Solid usageEng:An anthelmintic (Nematodes) Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Usage: | An anthelmintic (Nematodes) |
| Safety Data | |
| Hazard Symbols | |
 |
|
