| Identification | |
| Name: | 3-ethoxypropionic acid |
| Synonyms: | Ethoxypropionicacid; 98% |
| CAS: | 4324-38-3 |
| EINECS: | 224-357-9 |
| Molecular Formula: | C5H10O3 |
| Molecular Weight: | 118.13 |
| InChI: | InChI=1/C5H10O3/c1-2-8-4-3-5(6)7/h2-4H2,1H3,(H,6,7) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3265 |
| Flash Point: | 83.5°C |
| Boiling Point: | 203°Cat760mmHg |
| Density: | 1,05 g/cm3 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Packinggroup: | III |
| Flash Point: | 83.5°C |
| Safety Data | |
 |
|
