| Identification | |
| Name: | Trinitrophloroglucinol |
| Synonyms: | 2,4,6-Trinitro-1,3,5-benzenetriol |
| CAS: | 4328-17-0 |
| Molecular Formula: | C6H3N3O9 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C6H3N3O9/c10-4-1(7(13)14)5(11)3(9(17)18)6(12)2(4)8(15)16/h10-12H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 124.3°C |
| Boiling Point: | 290.4°C at 760 mmHg |
| Density: | 2.171g/cm3 |
| Refractive index: | 1.802 |
| Specification: |
Trinitrophloroglucinol , its cas register number is 4328-17-0. It also can be called 1,3,5-Benzenetriol, 2,4,6-trinitro- ; and Phloroglucinol, trinitro- . |
| Flash Point: | 124.3°C |
| Safety Data | |
 |
|
