| Identification | |
| Name: | 2-Pyridinemethanamine,N-phenyl- |
| Synonyms: | Pyridine,2-(anilinomethyl)- (7CI,8CI); 2-(Anilinomethyl)pyridine;N-(2-Pyridylmethyl)phenylamine |
| CAS: | 4329-81-1 |
| EINECS: | 224-364-7 |
| Molecular Formula: | C12H12 N2 |
| Molecular Weight: | 184.2371 |
| InChI: | InChI=1/C12H12N2/c1-2-6-11(7-3-1)14-10-12-8-4-5-9-13-12/h1-9,14H,10H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.131 g/cm3 |
| Refractive index: | 1.636 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Safety Data | |
 |
|
