| Identification | |
| Name: | Acetic acid,2,2-difluoro-, methyl ester |
| Synonyms: | Aceticacid, difluoro-, methyl ester (7CI,8CI,9CI);Difluoroacetic acid methyl ester;Methyl difluoroacetate; |
| CAS: | 433-53-4 |
| EINECS: | 207-089-7 |
| Molecular Formula: | C3H4F2O2 |
| Molecular Weight: | 110.06 |
| InChI: | InChI=1/C3H4F2O2/c1-7-3(6)2(4)5/h2H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993 |
| Flash Point: | 24 ºC |
| Density: | 1.272 |
| Refractive index: | 1.334 |
| Specification: | Safety Statements:16-23-36/37/39 16:Keep away from sources of ignition - No smoking 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Packinggroup: | II |
| Flash Point: | 24 ºC |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
