| Identification | |
| Name: | 1H-Pyrrole-2,5-dione,1-(4-nitrophenyl)- |
| Synonyms: | Maleimide,N-(p-nitrophenyl)- (6CI,7CI,8CI);1-(4-Nitrophenyl)-1H-pyrrole-2,5-dione;N-(4-Nitrophenyl) maleimide;N-(p-Nitrophenyl)maleimide;NSC 39726;NSC 55656;p-Nitrophenylmaleimide; |
| CAS: | 4338-06-1 |
| Molecular Formula: | C10H6N2O4 |
| Molecular Weight: | 218.17 |
| InChI: | InChI=1/C10H6N2O4/c13-9-5-6-10(14)11(9)7-1-3-8(4-2-7)12(15)16/h1-6H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 170°C |
| Flash Point: | 206.9°C |
| Boiling Point: | 418.5°Cat760mmHg |
| Density: | 1.535g/cm3 |
| Refractive index: | 1.666 |
| Specification: | Safety Statements:23-36/37/39 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 206.9°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
