Identification |
Name: | Adenosine,N-(2-furanylmethyl)- |
Synonyms: | Adenosine,N-furfuryl- (6CI,7CI,8CI);6-Furfuryladenosine;Furfuryladenosine;Kinetinriboside;N6-(2-Furanylmethyl)adenosine;N6-Furfuryladenosine;NSC 120958;Riboside, kinetin;Ribosylkinetin; |
CAS: | 4338-47-0 |
EINECS: | 224-389-3 |
Molecular Formula: | C15H17N5O5 |
Molecular Weight: | 347.33 |
InChI: | InChI=1/C15H17N5O5/c21-5-9-11(22)12(23)15(25-9)20-7-19-10-13(17-6-18-14(10)20)16-4-8-2-1-3-24-8/h1-3,6-7,9,11-12,15,21-23H,4-5H2,(H,16,17,18)/t9-,11-,12-,15-/m1/s1 |
Molecular Structure: |
 |
Properties |
Density: | 1.78g/cm3 |
Refractive index: | 1.798 |
Appearance: | white solid |
Specification: | White Solid usageEng:Used as an anticancer and antiviral agent Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
Usage: | Used as an anticancer and antiviral agent |
Safety Data |
|
 |