| Identification | |
| Name: | Boronic acid,B-(2-formyl-3-thienyl)- |
| Synonyms: | 2-Formyl-3-thiopheneboronic acid;2-Formylthien-3-ylboronic acid;Boronic acid, (2-formyl-3-thienyl)- (9CI);3-Thiopheneboronicacid, 2-formyl- (7CI,8CI); |
| CAS: | 4347-31-3 |
| EINECS: | -0 |
| Molecular Formula: | C5H5BO3S |
| Molecular Weight: | 155.97 |
| InChI: | InChI=1/C5H5BO3S/c7-3-5-4(6(8)9)1-2-10-5/h1-3,8-9H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 193.7°C |
| Boiling Point: | 396.7°Cat760mmHg |
| Density: | 1.41g/cm3 |
| Refractive index: | 1.573 |
| Appearance: | White to off-white or beige powder |
| Specification: |
2-Fluoro-4-nitrobenzotrifluoride , with CAS number of 4347-31-3, can be called 2-Formylthiophene-3-boronic acid ; (2-Formyl-3-thienyl)boronic acid ; 2-Formyl-3-thiopheneboronic acid ; 3-Boronothiophene-2-carboxaldehyde ; 2-Formylthiophene-3-Boronic ; 2-Formyl-3-thiopheneboronic acid,97% . 2-Formylthiophene-3-boronic acid (CAS NO.4347-31-3) is a white to off-white or beige powder. |
| Flash Point: | 193.7°C |
| Sensitive: | Air Sensitive |
| Safety Data | |
 |
|
