Identification |
Name: | 13H-4,6:21,24-Dietheno-8,12-metheno-1H-pyrido[3',2':14,15][1,11]dioxacycloeicosino[2,3,4-ij]isoquinoline-9,19-diol,2,3,13a,14,15,16,25,25a-octahydro-18,29-dimethoxy-1,14-dimethyl-, (13aR,25aR)- |
Synonyms: | Curine(6CI,7CI,8CI); Tubocuraran-7',12'-diol, 6,6'-dimethoxy-2,2'-dimethyl-, (1b)-; (-)-Bebeerine; (-)-Curine;Aristolochine; Aristolochine (C36 alkaloid); MCMC 10271; NSC 77034;l-Bebeerine; l-Curine |
CAS: | 436-05-5 |
EINECS: | 207-109-4 |
Molecular Formula: | C36H38 N2 O6 |
Molecular Weight: | 594.7 |
InChI: | InChI=1/C36H38N2O6/c1-37-13-11-23-18-31(41-3)32-20-26(23)27(37)15-21-5-8-25(9-6-21)43-36-34-24(19-33(42-4)35(36)40)12-14-38(2)28(34)16-22-7-10-29(39)30(17-22)44-32/h5-10,17-20,27-28,39-40H,11-16H2,1-4H3/t27-,28-/m1/s1 |
Molecular Structure: |
|
Properties |
Transport: | UN 1544 |
Flash Point: | 381.1°C |
Boiling Point: | 706.5°Cat760mmHg |
Density: | 1.239g/cm3 |
Refractive index: | 1.619 |
Specification: | Safety Statements:22-36/37/39-45 22:Do not breathe dust 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection 45:In case of accident or if you feel unwell, seek medical
advice immediately (show label where possible) |
Flash Point: | 381.1°C |
Storage Temperature: | 2-8°C |
Safety Data |
Hazard Symbols |
T+: Very toxic
|
|
|