| Identification | |
| Name: | Borane,fluorobis(2,4,6-trimethylphenyl)- |
| Synonyms: | Borane,fluorodimesityl- (8CI); Borine, fluorodimesityl- (6CI); Dimesitylboronfluoride; Dimesitylfluoroborane; Fluorobis(2,4,6-trimethylphenyl)borane;Fluorodimesitylborane |
| CAS: | 436-59-9 |
| Molecular Formula: | C18H22 B F |
| Molecular Weight: | 268.18 |
| InChI: | InChI=1/C18H22BF/c1-11-7-13(3)17(14(4)8-11)19(20)18-15(5)9-12(2)10-16(18)6/h7-10H,1-6H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3261 8/PG 2 |
| Melting Point: | 69-72 °C(lit.) |
| Flash Point: | 174.1°C |
| Boiling Point: | 364.2°C at 760 mmHg |
| Density: | 0.98g/cm3 |
| Refractive index: | 1.518 |
| Specification: | Safety Statements:26-27-28-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 27:Take off immediately all contaminated clothing 28:After contact with skin, wash immediately with plenty of ... (to be specified by the manufacturer) 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | III |
| Flash Point: | 174.1°C |
| Safety Data | |
| Hazard Symbols |
C: Corrosive
|
 |
|
