| Identification | |
| Name: | 2-Propenoic acid,3-phenyl-, 3-(diethylamino)propyl ester |
| Synonyms: | Cinnamicacid, 3-(diethylamino)propyl ester (8CI); 1-Propanol, 3-(diethylamino)-,cinnamate (ester); Apothesine |
| CAS: | 4361-80-2 |
| Molecular Formula: | C16H23 N O2 |
| Molecular Weight: | 261.40 |
| InChI: | InChI=1/C16H23NO2/c1-3-17(4-2)13-8-14-19-16(18)12-11-15-9-6-5-7-10-15/h5-7,9-12H,3-4,8,13-14H2,1-2H3/b12-11+ |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 127.8°C |
| Boiling Point: | 378.5°C at 760 mmHg |
| Density: | 1.018g/cm3 |
| Refractive index: | 1.536 |
| Specification: |
The extinguishing agent of Apothesine (CAS No. 4361-80-2) are dry powder, foam, sand, carbon dioxide, water mist. |
| Flash Point: | 127.8°C |
| Safety Data | |
 |
|
