Identification |
Name: | Furo[3',4':6,7]naphtho[2,3-d]-1,3-dioxol-6(5aH)-one,5,8,8a,9-tetrahydro-9-hydroxy-5-(3,4,5-trimethoxyphenyl)-, (5R,5aR,8aR,9S)- |
Synonyms: | Epipodophyllotoxin(6CI,8CI); Furo[3',4':6,7]naphtho[2,3-d]-1,3-dioxol-6(5aH)-one,5,8,8a,9-tetrahydro-9-hydroxy-5-(3,4,5-trimethoxyphenyl)-, [5R-(5a,5ab,8aa,9b)]-; (-)-Epipodophyllotoxin |
CAS: | 4375-07-9 |
Molecular Formula: | C22H22 O8 |
Molecular Weight: | 414.44 |
InChI: | InChI=1/C22H22O8/c1-25-16-4-10(5-17(26-2)21(16)27-3)18-11-6-14-15(30-9-29-14)7-12(11)20(23)13-8-28-22(24)19(13)18/h4-7,13,18-20,23H,8-9H2,1-3H3/t13-,18+,19-,20+/m0/s1 |
Molecular Structure: |
|
Properties |
Flash Point: | 210.2°C |
Boiling Point: | 597.9°C at 760 mmHg |
Density: | 1.37g/cm3 |
Refractive index: | 1.605 |
Specification: |
Epipodophyllotoxins are alkaloids naturally occurring in the root of American Mayapple plant (Podophyllum peltatum).
Some epipodophyllotoxin derivatives are currently used in the treatment of cancer. These include etoposide and teniposide. They act as anti-cancer drugs by inhibiting topoisomerase II.
|
Flash Point: | 210.2°C |
Safety Data |
|
|