| Identification | |
| Name: | 1,2-Benzenedicarboxylicacid, 1-methyl ester |
| Synonyms: | 1,2-Benzenedicarboxylicacid, monomethyl ester (9CI);Phthalic acid, methyl ester (6CI,7CI);Phthalicacid, monomethyl ester (8CI);2-(1-Methoxycarbonyl)benzoic acid;2-(Methoxycarbonyl)benzoic acid;D 3;D 3 (ester);Methyl 2-carboxybenzoate;Methyl hydrogen phthalate;Methyl phthalate;Monomethyl phthalate;NSC 8281;o-(Methoxycarbonyl)benzoic acid; |
| CAS: | 4376-18-5 |
| EINECS: | 224-476-6 |
| Molecular Formula: | C9H8O4 |
| Molecular Weight: | 180.16 |
| InChI: | InChI=1/C9H8O4/c1-13-9(12)7-5-3-2-4-6(7)8(10)11/h2-5H,1H3,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.288 g/cm3 |
| Appearance: | white to off-white crystalline powder |
| Specification: | white to off-white crystalline powder usageEng:Phthalate Ester metabolite, linked to precocious puberty. Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Storage Temperature: | Refrigerator |
| Usage: | Phthalate Ester metabolite, linked to precocious puberty. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
