| Identification | |
| Name: | 1,2-Benzenedicarboxylicacid, 1-(2-ethylhexyl) ester |
| Synonyms: | 1,2-Benzenedicarboxylicacid, mono(2-ethylhexyl) ester (9CI);Phthalic acid, 2-ethylhexyl ester(6CI,7CI);Phthalic acid, mono(2-ethylhexyl) ester (8CI);2-Ethylhexyl hydrogenphthalate;BAR 1;Mono(2-ethylhexyl) phthalate;Mono(ethylhexyl) phthalate; |
| CAS: | 4376-20-9 |
| EINECS: | 224-477-1 |
| Molecular Formula: | C16H22O4 |
| Molecular Weight: | 278.38 |
| InChI: | InChI=1/C16H22O4/c1-3-5-8-12(4-2)11-20-16(19)14-10-7-6-9-13(14)15(17)18/h6-7,9-10,12H,3-5,8,11H2,1-2H3,(H,17,18) |
| Molecular Structure: |  |
| Properties | |
| Density: | 0,107 g/cm3 |
| Specification: | Colorless Oil usageEng:Phthalate metabolite, responsible for inducing apoptosis in germ and Sertoli cells by disrupting junction complexes. Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Storage Temperature: | Refrigerator |
| Usage: | Phthalate metabolite, responsible for inducing apoptosis in germ and Sertoli cells by disrupting junction complexes. |
| Safety Data | |
 |
|
