Identification |
Name: | 5H-Dibenzo[a,d]cycloheptene-5-propanamine,N-methyl- |
Synonyms: | 5H-Dibenzo[a,d]cycloheptene-5-propylamine,N-methyl- (7CI,8CI); 5-(3-Methylaminopropyl)-5H-dibenzo[a,d]cycloheptene;7-(3-Methylaminopropyl)-1,2:5,6-dibenzocycloheptatriene; Amimetilina; MK 240;N-3-(5H-Dibenzo[a,d]cyclohepten-5-yl)propyl-N-methylamine;N-Methyl-5H-dibenzo[a,d]cycloheptene-5-propylamine; Protriptyline;Protryptyline; Triptil |
CAS: | 438-60-8 |
EINECS: | 207-119-9 |
Molecular Formula: | C19H21 N |
Molecular Weight: | 263.3767 |
InChI: | InChI=1S/C19H21N/c1-20-14-6-11-19-17-9-4-2-7-15(17)12-13-16-8-3-5-10-18(16)19/h2-5,7-10,12-13,19-20H,6,11,14H2,1H3 |
Molecular Structure: |
|
Properties |
Density: | 1.026 g/cm3 |
Specification: |
N-3-(5h-Dibenzo(A,D)Cyclohepten-5-Yl)Propyl-N-Methylamine (CAS NO.438-60-8) (Vivactil) is a tricyclic antidepressant (TCA), specifically a secondary amine, indicated for depression and ADHD. Unique among the TCAs, protriptyline tends to be energizing instead of sedating, and it is sometimes used in narcolepsy to achieve a wakefulness-promoting effect.[citation needed] (the other TCAs tend to be sedating and therefore are often taken in the evening).
|
Safety Data |
|
|