| Identification | |
| Name: | Benzoic acid,2-amino-6-methyl- |
| Synonyms: | o-Toluicacid, 6-amino- (6CI,8CI);6-Amino-o-toluic acid;6-Methyl-2-aminobenzoic acid;6-Methylanthranilic acid;ACR 1308; |
| CAS: | 4389-50-8 |
| EINECS: | -0 |
| Molecular Formula: | C8H9NO2 |
| Molecular Weight: | 151.16 |
| InChI: | InChI=1/C8H9NO2/c1-5-3-2-4-6(9)7(5)8(10)11/h2-4H,9H2,1H3,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 144.4 ºC |
| Boiling Point: | 315.1 ºC at 760 mmHg |
| Density: | 1.254 g/cm3 |
| Appearance: | Pale yellow powder |
| Specification: | Beige to pink powder Safety Statements:26-36-24/25 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 24/25:Avoid contact with skin and eyes |
| Flash Point: | 144.4 ºC |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
