| Identification | |
| Name: | Urea phosphate |
| Synonyms: | Urea rock phosphate;C 904 (flame retardant);Urea orthophosphate;Calmuril;Urea phosphate(UAP);Onychomal;Nutraplus;Ureaphil;Rea-Lo;Urea phosphoric acid;Urea,compounds,phosphate;Aquadrate;Phosphoric acid compd. with urea;Basodexan; |
| CAS: | 4401-74-5 |
| EINECS: | 224-534-0 |
| Molecular Formula: | CH4N2O.xH3O4P |
| Molecular Weight: | 158.050441 g/mol |
| InChI: | InChI=1S/CH4N2O.H3O4P/c2-1(3)4;1-5(2,3)4/h(H4,2,3,4);(H3,1,2,3,4) |
| Molecular Structure: |  |
| Properties | |
| Appearance: | White crystal |
| Specification: |
Urea phosphate (CAS NO.4401-74-5) is also named as Aquadrate ; Basodexan ; C 904 ; C 904 (Flame retardant) ; Calmurid ; Calmuril ; Carbamido-orthophosphat ; Carbamido-orthophosphat [German] ; Nubral ; Nutraplus ; Onychomal ; Phosphoric acid compd. with urea ; Phosphoric acid urea salt ; Rea-Lo ; Urea orthophosphate ; Urea phosphoric acid ; Urea rock phosphate ; Ureaphil . |
| Safety Data | |
 |
|
