| Identification | |
| Name: | Benzeneacetamide, a-hydroxy- |
| CAS: | 4410-31-5 |
| Molecular Formula: | C8H9 N O2 |
| Molecular Weight: | 151.16256 |
| InChI: | InChI=1S/C8H9NO2/c9-8(11)7(10)6-4-2-1-3-5-6/h1-5,7,10H,(H2,9,11) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.246 g/cm3 |
| Water Solubility: | Soluble in water |
| Solubility: | Soluble in water |
| Appearance: | white Crystalline powder |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
