| Identification | |
| Name: | 2(5H)-Furanone,5,5'-oxybis[3,4-dichloro- |
| Synonyms: | Crotonicacid, 4,4'-oxybis[2,3-dichloro-4-hydroxy-, di-g-lactone (6CI,7CI); GC 2466; Mucochloric anhydride;NSC 14027 |
| CAS: | 4412-09-3 |
| Molecular Formula: | C8H2 Cl4 O5 |
| Molecular Weight: | 319.90 |
| InChI: | InChI=1/C8H2Cl4O5/c9-1-3(11)7(15-5(1)13)17-8-4(12)2(10)6(14)16-8/h7-8H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 225.4°C |
| Boiling Point: | 498.4°Cat760mmHg |
| Density: | 1.88g/cm3 |
| Refractive index: | 1.606 |
| Specification: |
Mucochloric anhydride (CAS NO.4412-09-3) is also called 5,5'-Oxybis(3,4-dichloro-2(5H)-furanone) ; AI3-18618 ; Bis(3,4-dichloro-2(5)-furanonyl) ether ; Bis(3,4-dichlorofuranon-5-yl-2) ether ; Caswell No. 584A ; Crotonic acid, 4,4'-oxybis(2,3-dichloro-4-hydroxy-, di-gamma-lactone ; EPA Pesticide Chemical Code 584200 ; GC-2466 ; NSC 14027 ; 2(5H)-Furanone, 5,5'-oxybis(3,4-dichloro- . Mucochloric anhydride (CAS NO.4412-09-3) is high toxic. It will produce toxic chlorine gas when buring. So the storage environment should be ventilate, low-temperature and dry. Keep Mucochloric anhydride (CAS NO.4412-09-3) separate from raw materials of food. |
| Flash Point: | 225.4°C |
| Safety Data | |
 |
|
