| Identification | |
| Name: | Piperonylonitrile |
| Synonyms: | 3,4-(Methylenedioxy)benzonitrile; Piperonylonitrile, (3,4-Methylenedioxybenzonitrile); 1,3-Benzodioxole-5-carbonitrile~3,4-(Methylenedioxy)benzonitrile |
| CAS: | 4421-09-4 |
| EINECS: | 224-590-6 |
| Molecular Formula: | C8H5NO2 |
| Molecular Weight: | 147.13 |
| InChI: | InChI=1/C8H5NO2/c9-4-6-1-2-7-8(3-6)11-5-10-7/h1-3H,5H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3276 |
| Density: | 1.34 g/cm3 |
| Refractive index: | 1.597 |
| Appearance: | Solid needle-formed crystal |
| Specification: |
Piperonylonitrile , its cas register number is 4421-09-4. It also can be called 3,4-Methylenedioxybenzonitrile ; Benzonitrile, 3,4-methylenedioxy- ; Benzo-1,3-dioxole-5-carbonitrile .It is a white to beige crystalline powder or needles. |
| Packinggroup: | III |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
