Identification |
Name: | 1-Propanone,1-(5-fluoro-2-hydroxyphenyl)- |
Synonyms: | Propiophenone,5'-fluoro-2'-hydroxy- (7CI,8CI); 5'-Fluoro-2'-hydroxypropiophenone |
CAS: | 443-09-4 |
Molecular Formula: | C9H9 F O2 |
Molecular Weight: | 168.16 |
InChI: | InChI=1/C9H9FO2/c1-2-8(11)7-5-6(10)3-4-9(7)12/h3-5,12H,2H2,1H3 |
Molecular Structure: |
 |
Properties |
Melting Point: | 35-39 °C
|
Flash Point: | 107.5°C |
Boiling Point: | 254.1°Cat760mmHg |
Density: | 1.2g/cm3 |
Refractive index: | 1.522 |
Specification: | Safety Statements:26-39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 39:Wear eye/face protection |
Flash Point: | 107.5°C |
Safety Data |
Hazard Symbols |
Xn: Harmful
Xi: Irritant
|
|
 |