Identification |
Name: | Benzene,1,3-dibromo-5-fluoro-2-methoxy- |
Synonyms: | 2,6-Dibromo-4-fluorophenyl methyl ether;1,3-Dibromo-5-fluoro-2-methoxybenzene; |
CAS: | 443-41-4 |
Molecular Formula: | C7H5Br2FO |
Molecular Weight: | 283.92 |
InChI: | InChI=1/C7H5Br2FO/c1-11-7-5(8)2-4(10)3-6(7)9/h2-3H,1H3 |
Molecular Structure: |
|
Properties |
Flash Point: | 132.1°C |
Boiling Point: | 260.1°Cat760mmHg |
Density: | 1.892g/cm3 |
Refractive index: | 1.557 |
Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Flash Point: | 132.1°C |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
|