| Identification | |
| Name: | 2-Chloro-6-Fluorotoluene |
| Synonyms: | Toluene,2-chloro-6-fluoro- (7CI,8CI);1-Chloro-3-fluoro-2-methylbenzene;Benzene,1-chloro-3-fluoro-2-methyl-;2-Fluoro-6-chlorotoluene;6-Chloro-2-fluorotoluene; |
| CAS: | 443-83-4 |
| EINECS: | 207-141-9 |
| Molecular Formula: | C7H6ClF |
| Molecular Weight: | 144.57 |
| InChI: | InChI=1/C7H6ClF/c1-5-6(8)3-2-4-7(5)9/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993 |
| Density: | 1.191 |
| Refractive index: | 1.502-1.504 |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | colorless to light yellow liquid |
| Specification: |
2-Chloro-6-Fluorotoluene (CAS NO.443-83-4) is also named as 1-Chloro-3-fluoro-2-methylbenzene ; Benzene, 1-chloro-3-fluoro-2-methyl- . 2-Chloro-6-Fluorotoluene (CAS NO.443-83-4) is colorless to light yellow liquid. It is insoluble in water, soluble in toluene, ether and other solvents. |
| Packinggroup: | III |
| Storage Temperature: | Flammables area |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
