| Identification | |
| Name: | 1,3-Benzodioxole,5-(isothiocyanatomethyl)- |
| Synonyms: | Isothiocyanicacid, piperonyl ester (7CI,8CI);3,4-Methylenedioxybenzyl isothiocyanate;5-(Isothiocyanatomethyl)benzo[d][1,3]dioxole;Piperonyl isothiocyanate;2H-Benzo[3,4-d]1,3-dioxolen-5-ylmethanisothiocyanate; |
| CAS: | 4430-47-1 |
| EINECS: | -0 |
| Molecular Formula: | C9H7NO2S |
| Molecular Weight: | 193.22 |
| InChI: | InChI=1/C9H7NO2S/c13-5-10-4-7-1-2-8-9(3-7)12-6-11-8/h1-3H,4,6H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2810 |
| Flash Point: | 147.6°C |
| Density: | 1.32 |
| Refractive index: | 1.6150 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Packinggroup: | II |
| Flash Point: | 147.6°C |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
