| Identification | |
| Name: | 1,3,5-Benzenetriacetic acid |
| Synonyms: | 2-[3,5-bis(carboxymethyl)phenyl]acetic acid; |
| CAS: | 4435-67-0 |
| Molecular Formula: | C12H12O6 |
| Molecular Weight: | 252.2201 |
| InChI: | InChI=1/C12H12O6/c13-10(14)4-7-1-8(5-11(15)16)3-9(2-7)6-12(17)18/h1-3H,4-6H2,(H,13,14)(H,15,16)(H,17,18) |
| Molecular Structure: | ![(C12H12O6) 2-[3,5-bis(carboxymethyl)phenyl]acetic acid;](https://img.guidechem.com/cas/gif/4435-67-0.gif) |
| Properties | |
| Flash Point: | 291°C |
| Boiling Point: | 534.2°Cat760mmHg |
| Density: | 1.468g/cm3 |
| Refractive index: | 1.61 |
| Specification: |
1,3,5-Benzenetriacetic acid , its cas register number is 4435-67-0. It also can be called Benzene-1,3,5-triacetic acid ; and 1,3,5-Tris(carboxymethyl)benzene . |
| Flash Point: | 291°C |
| Safety Data | |
 |
|
