| Identification | |
| Name: | 1,4-Benzodioxin-5-carboxylicacid, 2,3-dihydro- |
| Synonyms: | 1,4-Benzodioxan-5-carboxylicacid (8CI);1,4-Benzodioxane-5-carboxylic acid;2,3-Dihydro-1,4-benzodioxin-5-carboxylic acid;2,3-Dihydrobenzo[1,4]dioxine-5-carboxylic acid; |
| CAS: | 4442-53-9 |
| EINECS: | 224-670-0 |
| Molecular Formula: | C9H8O4 |
| Molecular Weight: | 180.16 |
| InChI: | InChI=1/C9H8O4/c10-9(11)6-2-1-3-7-8(6)13-5-4-12-7/h1-3H,4-5H2,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.376 g/cm3 |
| Refractive index: | 1.587 |
| Appearance: | white to light yellow crystal powder |
| Specification: |
1,4-Benzodioxin-5-carboxylicacid, 2,3-dihydro- , its cas register number is 4442-53-9. It also can be called 2,3-Dihydro-1,4-benzodioxine-5-carboxylic acid ; 1,4-Benzodioxan-5-carboxylic acid . 1,4-Benzodioxin-5-carboxylicacid, 2,3-dihydro- (CAS NO.4442-53-9) is irritating to eyes, respiratory system and skin. In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
