| Identification | |
| Name: | 2-Fluorobenzoic acid |
| Synonyms: | Fluorobenzoicacidminwhitepowder; O-Fluorobenzoic acid |
| CAS: | 445-29-4 |
| EINECS: | 207-158-1 |
| Molecular Formula: | C7H5FO2 |
| Molecular Weight: | 140.11 |
| InChI: | InChI=1/C7H5FO2/c8-6-4-2-1-3-5(6)7(9)10/h1-4H,(H,9,10) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 50kgs |
| Flash Point: | 109 C |
| Density: | 1.319 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Water Solubility: | soluble AUTOIGNITION |
| Solubility: | soluble AUTOIGNITION |
| Appearance: | white to yellow crystalline powder |
| Specification: | white to light yellow crystal powder usageEng:Meclofenamic Acid intermediate. Safety Statements:22-26-28-24/25-37/39-36 22:Do not breathe dust 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 28:After contact with skin, wash immediately with plenty of ... (to be specified by the manufacturer) 24/25:Avoid contact with skin and eyes 37/39:Wear suitable protective clothing, gloves and eye/face protection 36:Wear suitable protective clothing |
| HS Code: | 29163900 |
| Flash Point: | 109 C |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Meclofenamic Acid intermediate. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
