| Identification | |
| Name: | Ethanone,1-(2-fluoro-5-methylphenyl)- |
| Synonyms: | Acetophenone,2'-fluoro-5'-methyl- (7CI,8CI); 2'-Fluoro-5'-methylacetophenone |
| CAS: | 446-07-1 |
| Molecular Formula: | C9H9 F O |
| Molecular Weight: | 152.17 |
| InChI: | InChI=1/C9H9FO/c1-6-3-4-9(10)8(5-6)7(2)11/h3-5H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 81.1°C |
| Boiling Point: | 212.7°Cat760mmHg |
| Density: | 1.075g/cm3 |
| Refractive index: | 1.509 |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 81.1°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
