Identification |
Name: | Ethanone,1-(2-fluoro-5-methylphenyl)- |
Synonyms: | Acetophenone,2'-fluoro-5'-methyl- (7CI,8CI); 2'-Fluoro-5'-methylacetophenone |
CAS: | 446-07-1 |
Molecular Formula: | C9H9 F O |
Molecular Weight: | 152.17 |
InChI: | InChI=1/C9H9FO/c1-6-3-4-9(10)8(5-6)7(2)11/h3-5H,1-2H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 81.1°C |
Boiling Point: | 212.7°Cat760mmHg |
Density: | 1.075g/cm3 |
Refractive index: | 1.509 |
Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36:Wear suitable protective clothing |
Flash Point: | 81.1°C |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
 |