| Identification | |
| Name: | 4-Fluoro-2-nitrotoluene |
| Synonyms: | Fluoronitrotoluene4 |
| CAS: | 446-10-6 |
| EINECS: | 207-161-8 |
| Molecular Formula: | C7H6FNO2 |
| Molecular Weight: | 155.13 |
| InChI: | InChI=1/C7H6FNO2/c1-5-2-3-6(8)4-7(5)9(10)11/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN2811 |
| Density: | 137 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.5218-1.5238 |
| Solubility: | Insoluble |
| Appearance: | colorless to light yellow liquid |
| Specification: | colorless to light yellow liqui Safety Statements:26-45-37-28A 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 37:Wear suitable gloves |
| Packinggroup: | III |
| Storage Temperature: | Keep away from heat and flame. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
