| Identification | |
| Name: | 2,4-Difluoronitrobenzene |
| Synonyms: | 1,3-difluoro-4-nitrobenzene |
| CAS: | 446-35-5 |
| EINECS: | 207-167-0 |
| Molecular Formula: | C6H3F2NO2 |
| Molecular Weight: | 159.09 |
| InChI: | InChI=1/C6H3F2NO2/c7-4-1-2-6(9(10)11)5(8)3-4/h1-3H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 281 |
| Density: | 1.451 |
| Stability: | Stable. Incompatible with strong bases, strong oxidizing agents. Combustible. |
| Refractive index: | 1.511-1.513 |
| Water Solubility: | Insoluble |
| Solubility: | Insoluble |
| Appearance: | clear to yellowish liquid |
| Specification: | yellow liquid Safety Statements:26-45-36/37/39-23 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) |
| Packinggroup: | III |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
