| Identification | |
| Name: | Phenol,5-fluoro-2-nitro- |
| Synonyms: | 2-Nitro-5-fluorophenol;3-Fluoro-6-nitrophenol;4-Fluoro-2-hydroxy-1-nitrobenzene;4-Fluoro-2-hydroxynitrobenzene;NSC 10284; |
| CAS: | 446-36-6 |
| EINECS: | 207-168-6 |
| Molecular Formula: | C6H4FNO3 |
| Molecular Weight: | 157.1 |
| InChI: | InChI=1/C6H4FNO3/c7-4-1-2-5(8(10)11)6(9)3-4/h1-3,9H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.511 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Water Solubility: | slightly soluble |
| Solubility: | slightly soluble in Water |
| Appearance: | white to light yellow crystal powder |
| Specification: |
Phenol,5-fluoro-2-nitro- with cas registry number of 446-36-6 is also called NSC 10284 ; 5-Fluoro-2-nitrophenol . |
| Packinggroup: | I; II; III |
| HS Code: | 29089000 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | yellow |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
