| Identification | |
| Name: | Genistein |
| Synonyms: | 4H-1-Benzopyran-4-one, 5, 7-dihydroxy-3- (4-hydroxyphenyl)-;5,7-dihydroxy-3-(4-hydroxyphenyl)-4H-chromen-4-one;5,7-dihydroxy-3-(4-hydroxyphenyl)chromen-4-one;Prunetol;Isoflavone, 4,5,7-trihydroxy-;4H-1-Benzopyran-4-one, 5,7-dihydroxy-3-(4-hydroxyphenyl)-;SIPI 807-1;5,7-Dihydroxy-3-(4-hydroxyphenyl)-4-benzopyrone;5-18-04-00594 (Beilstein Handbook Reference);C.I. 75610;NPI 031L;4,5,7-Trihydroxyisoflavone;4',5,7-trihydroxyisoflavone;4,5, 7-Trihydroxyisoflavone;Genisteol;Baichanin A;Differenol A;4H-1-Benzopyran-4-one,5,7-dihydroxy-3- (4-hydroxyphenyl)-;Genisterin;Sophoricol;5,7,4-Trihydroxyisoflavone;Genistein 4,5,7-Trihydroxyisoflavone; |
| CAS: | 446-72-0 |
| EINECS: | 207-174-9 |
| Molecular Formula: | C15H10O5 |
| Molecular Weight: | 270.24 |
| InChI: | InChI=1/C15H10O5/c16-9-3-1-8(2-4-9)11-7-20-13-6-10(17)5-12(18)14(13)15(11)19/h1-7,16-18H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.548 g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.732 |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | Yellow Crystalline Solid |
| Specification: |
?Biological effects of Genistein (CAS NO.446-72-0) are some isoflavones act as antioxidants to counteract damaging effects of free radicals in tissues; Genistein protects against pro-inflammatory factor-induced vascular endothelial barrier dysfunction and inhibits leukocyte-endothelium interaction, thereby modulating vascular inflammation, a major event in the pathogenesis of atherosclerosis and it?makes some cells more sensitive to radio-therapy. |
| Report: |
? Genistein (CAS NO.446-72-0) is reported in EPA TSCA Inventory. |
| Color: | off-white |
| Usage: | Exhibits specific inhibitory activity against tyrosine kinases,including autophosphorylation of epidermal growth factor receptor kinase (IC50 - 2.6uM). Also inhibits other protein kinases through competitive inhibition of ATP. Inhibits tumor cell |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
