| Identification | ||
| Name: | 2,4,5-Trimethoxybenzaldehyde | |
| Synonyms: | 3,4,6-Trimethoxybenzaldehyde;Asaraldehyde;Asaronaldehyde;Asarylaldehyde;Gazarin;NSC 89299; | |
| CAS: | 4460-86-0 | |
| EINECS: | 224-713-3 | |
| Molecular Formula: | C10H12O4 | |
| Molecular Weight: | 196.2 | |
| InChI: | InChI=1/C10H12O4/c1-12-8-5-10(14-3)9(13-2)4-7(8)6-11/h4-6H,1-3H3 | |
| Molecular Structure: |  |
|
| Properties | ||
| Flash Point: | 149oC | |
| Boiling Point: | 140oC | |
| Density: | 1.133 g/cm3 | |
| Stability: | Stable under normal temperatures and pressures. | |
| Refractive index: | 1.524 | |
| Water Solubility: | <0.1 g/100 mL at 22 ºC | |
| Solubility: | <0.1 g/100 mL at 22 oC in water | |
| Appearance: | Beige powder. | |
| Specification: | white to light beige fine crystalline powder Safety Statements:22-24/25-45-36/37/39-27-26 22:Do not breathe dust 24/25:Avoid contact with skin and eyes 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 27:Take off immediately all contaminated clothing 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice | |
| Flash Point: | 149oC | |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. | |
| Sensitive: | Air Sensitive | |
| Safety Data | ||
| Hazard Symbols |
C: Corrosive
|
|
 |
||
