| Identification | |
| Name: | 3-(2,6-dichlorophenyl)-5-methylisoxazole-4-carbonyl chloride |
| Synonyms: | 3-(2,6-Dichlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl chloride |
| CAS: | 4462-55-9 |
| EINECS: | 224-723-8 |
| Molecular Formula: | C11H6Cl3NO2 |
| Molecular Weight: | 290.53 |
| InChI: | InChI=1/C11H6Cl3NO2/c1-5-8(11(14)16)10(15-17-5)9-6(12)3-2-4-7(9)13/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3261 |
| Flash Point: | 390.9°Cat760mmHg |
| Boiling Point: | 390.9°Cat760mmHg |
| Density: | 1.472g/cm3 |
| Refractive index: | 1.584 |
| Appearance: | Yellow to brown powder |
| Specification: |
4-Isoxazolecarbonylchloride, 3-(2,6-dichlorophenyl)-5-methyl- , its cas register number is 4462-55-9. It also can be called 3-(2,6-Dichlorophenyl)-5-methylisoxazole-4-carboxylic acid chloride . 4-Isoxazolecarbonylchloride, 3-(2,6-dichlorophenyl)-5-methyl- (CAS NO.4462-55-9) is a yellow to brown powde which may cause burns. |
| Flash Point: | 390.9°Cat760mmHg |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
