| Identification | |
| Name: | Carbon bromide (CBr3) |
| Synonyms: | Bromoform;tribromomethane;Methane, tribromo-;Tribrommethan;Methyl tribromide;Methenyl tribromide;75-25-2;Bromoforme;Bromoformio;Tribrommethaan;Tribromometan;Bromoforme [French];Bromoformio [Italian];Tribrommethaan [Dutch];Tribrommethan [German];NCI-C55130;Tribromometan [Italian];RCRA waste no. U225;RCRA waste number U225;CCRIS 98;CHEBI:38682;HSDB 2517;NSC 8019;EINECS 200-854-6;UN2515;BRN 1731048;AI3-28587;MBR;WLN: EYEE;UNII-TUT9J99IMU;AC1L1KM5;48539_SUPELCO;BIDD:ER0622;132942_ALDRICH;241032_ALDRICH;36972_RIEDEL;AC1Q240C;CHEMBL345248;36972_FLUKA;Bromoform [UN2515] [Poison];NSC8019;Tribromomethane; methyl tribromide;LS-64;Bromoform [UN2515] [Poison];NSC-8019;AR-1I0798;SBB070879;AG-G-99862;DB03054;InChI=1/CHBr3/c2-1(3)4/h1;NCGC00091318-01;NCGC00091318-02;B0806;S0653;T0348;C14707;4-01-00-00082 (Beilstein Handbook Reference);I14-6459;4471-18-5 |
| CAS: | 4471-18-5 |
| Molecular Formula: | CHBr3 |
| Molecular Weight: | 252.73064 |
| InChI: | InChI=1S/CHBr3/c2-1(3)4/h1H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 8.69 deg C |
| Solubility: | Miscible with ethanol, ether; soluble in benzene, ligroin, chloroform Sol in about 800 parts water; miscible with acetone, petroleum ether, oils Sol in solvent naphtha; fixed and volatile oils 0.3 g/100 ml water at 30 deg C 0.1 g/100 g water at 20 deg C In water, 3,100 mg/L at 25 deg C |
| Color: | Colorless heavy liquid Colorless to yellow liquid [Note: A solid below 47 degrees F]. |
| Safety Data | |
 |
|
