| Identification | |
| Name: | Butane,1-isothiocyanato-4-(methylsulfinyl)- |
| Synonyms: | Sulforaphane;4-Methylsulfinylbutyl isothiocyanate;Sulforaphan (6CI);Isothiocyanicacid, 4-(methylsulfinyl)butyl ester (8CI); |
| CAS: | 4478-93-7 |
| Molecular Formula: | C6H11NOS2 |
| Molecular Weight: | 177.3 |
| InChI: | InChI=1/C6H11NOS2/c1-10(8)5-3-2-4-7-6-9/h2-5H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.17g/cm3 |
| Solubility: | DMSO: 40 mg/mL, soluble |
| Appearance: | Light yellow liquid |
| Specification: |
Because EA is an electrophilic compound that is known to be capable of inducing expression of so-called phase 2 proteins, we sought to determine whether two other phase 2 enzyme inducers, oltipraz and DL-Sulforaphane (CAS NO.4478-93-7), also are capable of inhibiting HMGB1 release from immunostimulated macrophages. Incubating RAW 264.7 cells with either oltipraz or DL-sulforaphane inhibited LPS-induced HMGB1 secretion. Moreover, both EA and DL-sulforaphane inhibited relocalization of nuclear HMGB1 into the cytoplasm of LPS-stimulated RAW 264.7 cells. These data suggest that phase 2 inducers may exert anti-inflammatory effects by inhibiting secretion of the cytokine-like nuclear protein HMGB1. |
| Color: | slightly yellow |
| Usage: | Potent, selective inducer of phase II detoxification enzymes with anticarcinogenic properties. Occurs naturally in broccoli. It was found to inhibit chemically induced mammary tumor formation in rats. Antitumor agent |
| Safety Data | |
 |
|
