| Identification | |
| Name: | Fenuron TCA |
| CAS: | 4482-55-7 |
| EINECS: | 200-576-5 |
| Molecular Formula: | C9H12N2O . C2HCl3O2 |
| Molecular Weight: | 327.59 |
| InChI: | InChI=1/C9H12N2O.C2HCl3O2/c1-11(2)9(12)10-8-6-4-3-5-7-8;3-2(4,5)1(6)7/h3-7H,1-2H3,(H,10,12);(H,6,7) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 153.3°C |
| Boiling Point: | 329.8°C at 760 mmHg |
| Density: | g/cm3 |
| Specification: |
Fenuron TCA , its CAS NO. is 4482-55-7, the synonyms are 1,1-Dimethyl-3-phenylurea trichloroacetate ; 1,1-Dimethyl-3-phenyluronium trichloroacetate ; 3-Phenyl-1,1-dimethylurea, trichloroacetate ; Acetic acid, trichloro-, mixed with urea, 1,1-dimethyl-3-phenyl- (1:1) ; Caswell No. 655 ; EPA Pesticide Chemical Code 035508 ; Fenuron TCA salt ; Fenuron trichloroacetate ; GC-2603 ; N,N-Dimethyl-N'-phenyluronium trichloracetate ; Trichloracetic acid compound with N,N-dimethyl-N-phenylurea (1:1) ; Urab ; Urea, 1,1-dimethyl-3-phenyl-, trichloroacetate ; Acetic acid, trichloro-, compd. with 1,1-dimethyl-3- |
| Report: |
EPA FIFRA 1988 pesticide subject to registration or re-registration. |
| Flash Point: | 153.3°C |
| Safety Data | |
 |
|
