| Identification | |
| Name: | Benzene, 1-chloro-4-fluoro-2-methoxy- |
| Synonyms: | Anisole,6-chloro-3-fluoro- (8CI);1-Chloro-4-fluoro-2-methoxybenzene;2-Chloro-5-fluoroanisole; |
| CAS: | 450-89-5 |
| Molecular Formula: | C7H6ClFO |
| Molecular Weight: | 160.57 |
| InChI: | InChI=1/C7H6ClFO/c1-10-7-4-5(9)2-3-6(7)8/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1993 |
| Density: | 1.239g/cm3 |
| Refractive index: | 1.519 |
| Appearance: | clear colourless liquid |
| Specification: | CLEAR COLOURLESS LIQUID Safety Statements:16-26-36-37/39 16:Keep away from sources of ignition - No smoking 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
