Identification |
Name: | Phenol,4-fluoro-2-methoxy- |
Synonyms: | 2-Methoxy-4-fluorophenol; |
CAS: | 450-93-1 |
EINECS: | -0 |
Molecular Formula: | C7H7FO2 |
Molecular Weight: | 142.13 |
InChI: | InChI=1/C7H7FO2/c1-10-7-4-5(8)2-3-6(7)9/h2-4,9H,1H3 |
Molecular Structure: |
 |
Properties |
Transport: | 2735 |
Flash Point: | 215? |
Density: | 1.247 |
Refractive index: | 1.517 |
Appearance: | Clear slightly yellow liquid |
Specification: | Clear slightly yellow liquid Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36:Wear suitable protective clothing |
Flash Point: | 215? |
Safety Data |
Hazard Symbols |
Xi:Irritant
|
|
 |