| Identification | |
| Name: | Tricyclo[3.3.1.13,7]decan-2-one,oxime |
| Synonyms: | 2-Adamantanone,oxime (6CI,7CI,8CI);Tricyclo[3.3.1.13,7]decanone, oxime (9CI);2-Hydroxyiminoadamantane;Adamantanone oxime;NSC 127840;2-Adamantanone oxime; |
| CAS: | 4500-12-3 |
| EINECS: | 224-807-4 |
| Molecular Formula: | C10H15NO |
| Molecular Weight: | 165.23 |
| InChI: | InChI=1/C10H15NO/c12-11-10-8-2-6-1-7(4-8)5-9(10)3-6/h6-9,12H,1-5H2/b11-10- |
| Molecular Structure: | ![(C10H15NO) 2-Adamantanone,oxime (6CI,7CI,8CI);Tricyclo[3.3.1.13,7]decanone, oxime (9CI);2-Hydroxyiminoadamantan...](https://img1.guidechem.com/chem/e/dict/223/4500-12-3.jpg) |
| Properties | |
| Melting Point: | 164-167 ºC |
| Density: | 1.5 g/cm3 |
| Refractive index: | 1.752 |
| Appearance: | white solid |
| Specification: | Safety Statements:22-24/25 22:Do not breathe dust 24/25:Avoid contact with skin and eyes |
| Safety Data | |
 |
|
