| Identification | |
| Name: | 1,2,4,5-Benzenetetramine, tetrahydrochloride |
| Synonyms: | Benzene-1,2,4,5-tetrayltetraamine tetrahydrochloride;1,2,4,5-Benzenetetramine hydrochloride;1,2,4, 5-Tetraaminobenzene tetrahydrochloride;Benzene-1,2,4,5-tetramine; |
| CAS: | 4506-66-5 |
| EINECS: | 224-822-6 |
| Molecular Formula: | C6H10N4.4(HCl) |
| Molecular Weight: | 284.0142 |
| InChI: | InChI=1/C6H10N4/c7-3-1-4(8)6(10)2-5(3)9/h1-2H,7-10H2 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | ≥300 °C(lit.) |
| Flash Point: | 233.6°C |
| Boiling Point: | 400.9°Cat760mmHg |
| Density: | g/cm3 |
| Refractive index: | 1.827 |
| Appearance: | dark brown crystals |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Biological Activity: | Selective focal adhesion kinase (FAK) inhibitor that displays no significant activity at a range of other kinases including EGFR, PDGFR and IGF-RI. Prevents FAK autophosphorylation at Y397 (IC 50 = 1 μ M), promotes cell detachment and inhibits cell adhesion in vitro . Exhibits antiproliferative activity in a variety of human tumor cell lines in vitro and in breast cancer cells in vivo . |
| Flash Point: | 233.6°C |
| Storage Temperature: | Desiccate at RT |
| Safety Data | |
 |
|
